C20H22N4O2S — CID 110552922
1-propyl-3-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552922) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-propyl-3-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-propyl-3-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552922 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-propyl-3-(4-pyridin-2-ylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2cccs2)=C(N2CCN(c3ccccn3)CC2)C1=O |
| InChI | InChI=1S/C20H22N4O2S/c1-2-9-24-19(25)17(15-6-5-14-27-15)18(20(24)26)23-12-10-22(11-13-23)16-7-3-4-8-21-16/h3-8,14H,2,9-13H2,1H3 |
| InChIKey | MLVFIJFEJIOAIH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|