C13H14N2O2S — CID 110552990
1-methyl-3-pyrrolidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552990) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-methyl-3-pyrrolidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-methyl-3-pyrrolidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552990 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-methyl-3-pyrrolidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2cccs2)=C(N2CCCC2)C1=O |
| InChI | InChI=1S/C13H14N2O2S/c1-14-12(16)10(9-5-4-8-18-9)11(13(14)17)15-6-2-3-7-15/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | CMKPVFMCCRVAPZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|