C24H28N4O2S — CID 110552228
3-(4-ethylpiperazin-1-yl)-1-(4-pyrrolidin-1-ylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552228) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-1-(4-pyrrolidin-1-ylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-1-(4-pyrrolidin-1-ylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552228 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-1-(4-pyrrolidin-1-ylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3cccs3)C(=O)N(c3ccc(N4CCCC4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C24H28N4O2S/c1-2-25-13-15-27(16-14-25)22-21(20-6-5-17-31-20)23(29)28(24(22)30)19-9-7-18(8-10-19)26-11-3-4-12-26/h5-10,17H,2-4,11-16H2,1H3 |
| InChIKey | UDPFJIADWOADOS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|