C26H26N4O2S — CID 110591782
3-[4-(4-ethylpiperazin-1-yl)anilino]-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591782) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 3-[4-(4-ethylpiperazin-1-yl)anilino]-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[4-(4-ethylpiperazin-1-yl)anilino]-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591782 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-[4-(4-ethylpiperazin-1-yl)anilino]-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCN1CCN(c2ccc(NC3=C(c4cccs4)C(=O)N(c4ccccc4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C26H26N4O2S/c1-2-28-14-16-29(17-15-28)20-12-10-19(11-13-20)27-24-23(22-9-6-18-33-22)25(31)30(26(24)32)21-7-4-3-5-8-21/h3-13,18,27H,2,14-17H2,1H3 |
| InChIKey | FEKJLZXWOKYBCA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|