About 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione
1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591692) has the molecular formula C26H25N3O2S
and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| PubChem CID | 110591692 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)C(Nc3ccc(N4CCCC4)cc3)=C(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C26H25N3O2S/c1-17-7-8-18(2)21(16-17)29-25(30)23(22-6-5-15-32-22)24(26(29)31)27-19-9-11-20(12-10-19)28-13-3-4-14-28/h5-12,15-16,27H,3-4,13-14H2,1-2H3 |
| InChIKey | AXNNALAQFNXADQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione?
The IUPAC name of 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione (CID 110591692) is 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
What is the SMILES notation for 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione?
The canonical SMILES for 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione is Cc1ccc(C)c(N2C(=O)C(Nc3ccc(N4CCCC4)cc3)=C(c3cccs3)C2=O)c1.
What is the InChIKey of 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione?
The InChIKey is AXNNALAQFNXADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O2S/c1-17-7-8-18(2)21(16-17)29-25(30)23(22-6-5-15-32-22)24(26(29)31)27-19-9-11-20(12-10-19)28-13-3-4-14-28/h5-12,15-16,27H,3-4,13-14H2,1-2H3.
What are the key properties of 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione?
1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione has a molecular weight of 443.57 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione is sourced from PubChem (CID 110591692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).