C25H23N3O3S — CID 110591552
1-(4-methoxyphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591552) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591552 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(4-pyrrolidin-1-ylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(Nc3ccc(N4CCCC4)cc3)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-31-20-12-10-19(11-13-20)28-24(29)22(21-5-4-16-32-21)23(25(28)30)26-17-6-8-18(9-7-17)27-14-2-3-15-27/h4-13,16,26H,2-3,14-15H2,1H3 |
| InChIKey | XGBUNZQPECQPGB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|