C21H14Cl2N2O3S — CID 110592498
1-(2,3-dichlorophenyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110592498) has the molecular formula C21H14Cl2N2O3S and a molecular weight of 445.33 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110592498 |
| Molecular Formula | C21H14Cl2N2O3S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3cccs3)C(=O)N(c3cccc(Cl)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O3S/c1-28-13-9-7-12(8-10-13)24-19-17(16-6-3-11-29-16)20(26)25(21(19)27)15-5-2-4-14(22)18(15)23/h2-11,24H,1H3 |
| InChIKey | YQLPNTMOVIAAEE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|