C28H28N4O3 — CID 110593504
3-(4-methoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-1-phenylpyrrole-2,5-dione (PubChem CID 110593504) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-1-phenylpyrrole-2,5-dione.
| Compound Name | 3-(4-methoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110593504 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-1-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Nc3ccc(N4CCN(C)CC4)cc3)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N4O3/c1-30-16-18-31(19-17-30)22-12-10-21(11-13-22)29-26-25(20-8-14-24(35-2)15-9-20)27(33)32(28(26)34)23-6-4-3-5-7-23/h3-15,29H,16-19H2,1-2H3 |
| InChIKey | LXMSURRNBQRLML-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|