C29H30N4O2 — CID 110595982
1-(2,4-dimethylphenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-4-phenylpyrrole-2,5-dione (PubChem CID 110595982) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595982 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-4-phenylpyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Nc3ccc(N4CCN(C)CC4)cc3)=C(c3ccccc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C29H30N4O2/c1-20-9-14-25(21(2)19-20)33-28(34)26(22-7-5-4-6-8-22)27(29(33)35)30-23-10-12-24(13-11-23)32-17-15-31(3)16-18-32/h4-14,19,30H,15-18H2,1-3H3 |
| InChIKey | QMCNONJULOXYDQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|