C27H25N3O3 — CID 110595827
1-(2-methoxyphenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110595827) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-methoxyphenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595827 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)C(Nc2ccc(N3CCCC3)cc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H25N3O3/c1-33-23-12-6-5-11-22(23)30-26(31)24(19-9-3-2-4-10-19)25(27(30)32)28-20-13-15-21(16-14-20)29-17-7-8-18-29/h2-6,9-16,28H,7-8,17-18H2,1H3 |
| InChIKey | SQGQTSNYICVEHZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|