C28H26FN3O2 — CID 110587443
3-(4-fluorophenyl)-1-(2-methylphenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110587443) has the molecular formula C28H26FN3O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(2-methylphenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1-(2-methylphenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587443 |
| Molecular Formula | C28H26FN3O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(2-methylphenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | Cc1ccccc1N1C(=O)C(Nc2ccc(N3CCCCC3)cc2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C28H26FN3O2/c1-19-7-3-4-8-24(19)32-27(33)25(20-9-11-21(29)12-10-20)26(28(32)34)30-22-13-15-23(16-14-22)31-17-5-2-6-18-31/h3-4,7-16,30H,2,5-6,17-18H2,1H3 |
| InChIKey | XDKWMPYFOFXSRU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|