C26H21ClFN3O2 — CID 110595469
1-(3-chloro-4-fluorophenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110595469) has the molecular formula C26H21ClFN3O2 and a molecular weight of 461.92 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595469 |
| Molecular Formula | C26H21ClFN3O2 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc(N3CCCC3)cc2)=C(c2ccccc2)C(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H21ClFN3O2/c27-21-16-20(12-13-22(21)28)31-25(32)23(17-6-2-1-3-7-17)24(26(31)33)29-18-8-10-19(11-9-18)30-14-4-5-15-30/h1-3,6-13,16,29H,4-5,14-15H2 |
| InChIKey | GUFCYSDKCRBPGG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|