C29H29N3O2 — CID 110600270
3-(3,5-dimethylanilino)-4-(4-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrole-2,5-dione (PubChem CID 110600270) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-4-(4-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylanilino)-4-(4-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110600270 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 3-(3,5-dimethylanilino)-4-(4-methylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Nc3cc(C)cc(C)c3)C(=O)N(c3ccc(N4CCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-19-6-8-22(9-7-19)26-27(30-23-17-20(2)16-21(3)18-23)29(34)32(28(26)33)25-12-10-24(11-13-25)31-14-4-5-15-31/h6-13,16-18,30H,4-5,14-15H2,1-3H3 |
| InChIKey | PGZHWTKXATXGNF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|