C27H23N3O2 — CID 110589852
4-[3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110589852) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110589852 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-[3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(C)cc(NC2=C(c3ccc(C)c(C)c3)C(=O)N(c3ccc(C#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H23N3O2/c1-16-11-17(2)13-22(12-16)29-25-24(21-8-5-18(3)19(4)14-21)26(31)30(27(25)32)23-9-6-20(15-28)7-10-23/h5-14,29H,1-4H3 |
| InChIKey | BRRPNLKLXUOJNG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|