C27H23N3O4 — CID 110597260
4-[3-(3,4-dimethoxyphenyl)-4-(3,5-dimethylanilino)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110597260) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-4-(3,5-dimethylanilino)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-4-(3,5-dimethylanilino)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110597260 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-4-(3,5-dimethylanilino)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | COc1ccc(C2=C(Nc3cc(C)cc(C)c3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C27H23N3O4/c1-16-11-17(2)13-20(12-16)29-25-24(19-7-10-22(33-3)23(14-19)34-4)26(31)30(27(25)32)21-8-5-18(15-28)6-9-21/h5-14,29H,1-4H3 |
| InChIKey | MQTLPCQRMJZJSA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|