C25H18N4O4 — CID 110585744
4-[3-(3,4-dimethylanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110585744) has the molecular formula C25H18N4O4 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3,4-dimethylanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110585744 |
| Molecular Formula | C25H18N4O4 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-[3-(3,4-dimethylanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | Cc1ccc(NC2=C(c3ccc([N+](=O)[O-])cc3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1C |
| InChI | InChI=1S/C25H18N4O4/c1-15-3-8-19(13-16(15)2)27-23-22(18-6-11-21(12-7-18)29(32)33)24(30)28(25(23)31)20-9-4-17(14-26)5-10-20/h3-13,27H,1-2H3 |
| InChIKey | CFOWNRBROUARSM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|