C23H13FN4O4 — CID 110585739
4-[3-(3-fluoroanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110585739) has the molecular formula C23H13FN4O4 and a molecular weight of 428.38 g/mol. Its IUPAC name is 4-[3-(3-fluoroanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3-fluoroanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110585739 |
| Molecular Formula | C23H13FN4O4 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-[3-(3-fluoroanilino)-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(Nc3cccc(F)c3)=C(c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H13FN4O4/c24-16-2-1-3-17(12-16)26-21-20(15-6-10-19(11-7-15)28(31)32)22(29)27(23(21)30)18-8-4-14(13-25)5-9-18/h1-12,26H |
| InChIKey | BGEOCEIZGBJHFB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|