C23H14F4N2O2 — CID 110596146
3-(3-fluoroanilino)-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110596146) has the molecular formula C23H14F4N2O2 and a molecular weight of 426.37 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3-fluoroanilino)-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110596146 |
| Molecular Formula | C23H14F4N2O2 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-(3-fluoroanilino)-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2cccc(F)c2)=C(c2ccccc2)C(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H14F4N2O2/c24-16-7-4-8-17(13-16)28-20-19(14-5-2-1-3-6-14)21(30)29(22(20)31)18-11-9-15(10-12-18)23(25,26)27/h1-13,28H |
| InChIKey | JAOPHWAJDGKGJP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|