C25H18F3N3O3 — CID 110596724
N-[4-[2,5-dioxo-1-phenyl-4-[3-(trifluoromethyl)anilino]pyrrol-3-yl]phenyl]acetamide (PubChem CID 110596724) has the molecular formula C25H18F3N3O3 and a molecular weight of 465.43 g/mol. Its IUPAC name is N-[4-[2,5-dioxo-1-phenyl-4-[3-(trifluoromethyl)anilino]pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[2,5-dioxo-1-phenyl-4-[3-(trifluoromethyl)anilino]pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110596724 |
| Molecular Formula | C25H18F3N3O3 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[4-[2,5-dioxo-1-phenyl-4-[3-(trifluoromethyl)anilino]pyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(Nc3cccc(C(F)(F)F)c3)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H18F3N3O3/c1-15(32)29-18-12-10-16(11-13-18)21-22(30-19-7-5-6-17(14-19)25(26,27)28)24(34)31(23(21)33)20-8-3-2-4-9-20/h2-14,30H,1H3,(H,29,32) |
| InChIKey | LHCVTHWMCCUWPK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|