C25H19N3O5 — CID 110563457
N-[4-[4-(1,3-benzodioxol-5-ylamino)-2,5-dioxo-1-phenylpyrrol-3-yl]phenyl]acetamide (PubChem CID 110563457) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is N-[4-[4-(1,3-benzodioxol-5-ylamino)-2,5-dioxo-1-phenylpyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(1,3-benzodioxol-5-ylamino)-2,5-dioxo-1-phenylpyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110563457 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[4-[4-(1,3-benzodioxol-5-ylamino)-2,5-dioxo-1-phenylpyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(Nc3ccc4c(c3)OCO4)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H19N3O5/c1-15(29)26-17-9-7-16(8-10-17)22-23(27-18-11-12-20-21(13-18)33-14-32-20)25(31)28(24(22)30)19-5-3-2-4-6-19/h2-13,27H,14H2,1H3,(H,26,29) |
| InChIKey | LIHZCKYSGHWINU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|