C25H18N2O6 — CID 110561768
3-(1,3-benzodioxol-5-ylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione (PubChem CID 110561768) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561768 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc3c(c2)OCO3)=C(c2ccccc2)C(=O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H18N2O6/c28-24-22(15-4-2-1-3-5-15)23(26-16-6-8-19-20(12-16)33-14-32-19)25(29)27(24)17-7-9-18-21(13-17)31-11-10-30-18/h1-9,12-13,26H,10-11,14H2 |
| InChIKey | JBFBJUKJRYVXGR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|