C25H18FN3O2 — CID 110587434
4-[3-(2,5-dimethylanilino)-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110587434) has the molecular formula C25H18FN3O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[3-(2,5-dimethylanilino)-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(2,5-dimethylanilino)-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110587434 |
| Molecular Formula | C25H18FN3O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-[3-(2,5-dimethylanilino)-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | Cc1ccc(C)c(NC2=C(c3ccc(F)cc3)C(=O)N(c3ccc(C#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H18FN3O2/c1-15-3-4-16(2)21(13-15)28-23-22(18-7-9-19(26)10-8-18)24(30)29(25(23)31)20-11-5-17(14-27)6-12-20/h3-13,28H,1-2H3 |
| InChIKey | ZPKUZSOFIWPUPL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|