C25H18FN3O3 — CID 110588402
4-[3-(4-ethoxyphenyl)-4-(4-fluoroanilino)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110588402) has the molecular formula C25H18FN3O3 and a molecular weight of 427.44 g/mol. Its IUPAC name is 4-[3-(4-ethoxyphenyl)-4-(4-fluoroanilino)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-ethoxyphenyl)-4-(4-fluoroanilino)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110588402 |
| Molecular Formula | C25H18FN3O3 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-[3-(4-ethoxyphenyl)-4-(4-fluoroanilino)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | CCOc1ccc(C2=C(Nc3ccc(F)cc3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H18FN3O3/c1-2-32-21-13-5-17(6-14-21)22-23(28-19-9-7-18(26)8-10-19)25(31)29(24(22)30)20-11-3-16(15-27)4-12-20/h3-14,28H,2H2,1H3 |
| InChIKey | PZTHRRSVOUUSTE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|