C26H22FN3O4 — CID 110596647
N-[4-[4-(4-ethoxyanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110596647) has the molecular formula C26H22FN3O4 and a molecular weight of 459.48 g/mol. Its IUPAC name is N-[4-[4-(4-ethoxyanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(4-ethoxyanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110596647 |
| Molecular Formula | C26H22FN3O4 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[4-[4-(4-ethoxyanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CCOc1ccc(NC2=C(c3ccc(NC(C)=O)cc3)C(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H22FN3O4/c1-3-34-22-14-10-20(11-15-22)29-24-23(17-4-8-19(9-5-17)28-16(2)31)25(32)30(26(24)33)21-12-6-18(27)7-13-21/h4-15,29H,3H2,1-2H3,(H,28,31) |
| InChIKey | CHHAPFVRBXUFFN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|