C26H21N3O4 — CID 110593770
4-[3-(4-ethoxyanilino)-4-(4-methoxyphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110593770) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-[3-(4-ethoxyanilino)-4-(4-methoxyphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-ethoxyanilino)-4-(4-methoxyphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110593770 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-[3-(4-ethoxyanilino)-4-(4-methoxyphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | CCOc1ccc(NC2=C(c3ccc(OC)cc3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21N3O4/c1-3-33-22-14-8-19(9-15-22)28-24-23(18-6-12-21(32-2)13-7-18)25(30)29(26(24)31)20-10-4-17(16-27)5-11-20/h4-15,28H,3H2,1-2H3 |
| InChIKey | PNLOWDNIORKBCO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|