C24H17F3N2O2 — CID 110587504
1-(3,4-difluorophenyl)-3-(2,5-dimethylanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110587504) has the molecular formula C24H17F3N2O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(2,5-dimethylanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(2,5-dimethylanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587504 |
| Molecular Formula | C24H17F3N2O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(2,5-dimethylanilino)-4-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C)c(NC2=C(c3ccc(F)cc3)C(=O)N(c3ccc(F)c(F)c3)C2=O)c1 |
| InChI | InChI=1S/C24H17F3N2O2/c1-13-3-4-14(2)20(11-13)28-22-21(15-5-7-16(25)8-6-15)23(30)29(24(22)31)17-9-10-18(26)19(27)12-17/h3-12,28H,1-2H3 |
| InChIKey | WQQICAXHTKNADO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|