C25H17ClN2O2S — CID 110550739
4-[3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110550739) has the molecular formula C25H17ClN2O2S and a molecular weight of 444.94 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110550739 |
| Molecular Formula | C25H17ClN2O2S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 4-[3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethylphenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | Cc1ccc(C2=C(Sc3ccc(Cl)cc3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1C |
| InChI | InChI=1S/C25H17ClN2O2S/c1-15-3-6-18(13-16(15)2)22-23(31-21-11-7-19(26)8-12-21)25(30)28(24(22)29)20-9-4-17(14-27)5-10-20/h3-13H,1-2H3 |
| InChIKey | JQJWSNIINJYORB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|