C30H32N2O2 — CID 110589471
1-(4-butylphenyl)-3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110589471) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110589471 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 1-(4-butylphenyl)-3-(3,5-dimethylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(Nc3cc(C)cc(C)c3)=C(c3ccc(C)c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H32N2O2/c1-6-7-8-23-10-13-26(14-11-23)32-29(33)27(24-12-9-21(4)22(5)18-24)28(30(32)34)31-25-16-19(2)15-20(3)17-25/h9-18,31H,6-8H2,1-5H3 |
| InChIKey | NXQUGBRCYFVMET-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|