C26H26N2O2S — CID 110591678
1-(4-butylphenyl)-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591678) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591678 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-(4-butylphenyl)-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(Nc3ccc(C)c(C)c3)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-4-5-7-19-10-13-21(14-11-19)28-25(29)23(22-8-6-15-31-22)24(26(28)30)27-20-12-9-17(2)18(3)16-20/h6,8-16,27H,4-5,7H2,1-3H3 |
| InChIKey | UUOYUKRKXFMIIK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|