C14H13I2NO2 — CID 100958944
1-(4-butylphenyl)-3,4-diiodopyrrole-2,5-dione (PubChem CID 100958944) has the molecular formula C14H13I2NO2 and a molecular weight of 481.07 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3,4-diiodopyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3,4-diiodopyrrole-2,5-dione |
|---|---|
| PubChem CID | 100958944 |
| Molecular Formula | C14H13I2NO2 |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.90 |
| IUPAC Name | 1-(4-butylphenyl)-3,4-diiodopyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(I)=C(I)C2=O)cc1 |
| InChI | InChI=1S/C14H13I2NO2/c1-2-3-4-9-5-7-10(8-6-9)17-13(18)11(15)12(16)14(17)19/h5-8H,2-4H2,1H3 |
| InChIKey | LBGNRVGDCOCXLS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|