C20H16Cl3NO2 — CID 110583993
1-(4-butylphenyl)-3-chloro-4-(2,4-dichlorophenyl)pyrrole-2,5-dione (PubChem CID 110583993) has the molecular formula C20H16Cl3NO2 and a molecular weight of 408.71 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-chloro-4-(2,4-dichlorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-chloro-4-(2,4-dichlorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583993 |
| Molecular Formula | C20H16Cl3NO2 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 1-(4-butylphenyl)-3-chloro-4-(2,4-dichlorophenyl)pyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(Cl)=C(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C20H16Cl3NO2/c1-2-3-4-12-5-8-14(9-6-12)24-19(25)17(18(23)20(24)26)15-10-7-13(21)11-16(15)22/h5-11H,2-4H2,1H3 |
| InChIKey | IZVGIHLXVWVDKM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|