C17H9Cl4NO3 — CID 110584016
3-chloro-1-(5-chloro-2-methoxyphenyl)-4-(2,4-dichlorophenyl)pyrrole-2,5-dione (PubChem CID 110584016) has the molecular formula C17H9Cl4NO3 and a molecular weight of 417.08 g/mol. Its IUPAC name is 3-chloro-1-(5-chloro-2-methoxyphenyl)-4-(2,4-dichlorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(5-chloro-2-methoxyphenyl)-4-(2,4-dichlorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584016 |
| Molecular Formula | C17H9Cl4NO3 |
| Molecular Weight | 417.08 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | 3-chloro-1-(5-chloro-2-methoxyphenyl)-4-(2,4-dichlorophenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)C(Cl)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C17H9Cl4NO3/c1-25-13-5-3-9(19)7-12(13)22-16(23)14(15(21)17(22)24)10-4-2-8(18)6-11(10)20/h2-7H,1H3 |
| InChIKey | IQRYUNHIDZDOEI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|