C13H8ClN3O3 — CID 20866768
6-(5-chloro-2-methoxyphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 20866768) has the molecular formula C13H8ClN3O3 and a molecular weight of 289.68 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 20866768 |
| Molecular Formula | C13H8ClN3O3 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)c2nccnc2C1=O |
| InChI | InChI=1S/C13H8ClN3O3/c1-20-9-3-2-7(14)6-8(9)17-12(18)10-11(13(17)19)16-5-4-15-10/h2-6H,1H3 |
| InChIKey | PUCIEHOKUOGLMS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|