C22H20Cl2N2O3 — CID 110571137
1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110571137) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571137 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)C(c2ccc(Cl)cc2)=C(N2CCCCC2)C1=O |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-29-18-10-9-16(24)13-17(18)26-21(27)19(14-5-7-15(23)8-6-14)20(22(26)28)25-11-3-2-4-12-25/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | BIWBYSFJKCTWJD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|