C21H18Cl2N2O4 — CID 110571142
1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 110571142) has the molecular formula C21H18Cl2N2O4 and a molecular weight of 433.29 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571142 |
| Molecular Formula | C21H18Cl2N2O4 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)C(c2ccc(Cl)cc2)=C(N2CCOCC2)C1=O |
| InChI | InChI=1S/C21H18Cl2N2O4/c1-28-17-7-6-15(23)12-16(17)25-20(26)18(13-2-4-14(22)5-3-13)19(21(25)27)24-8-10-29-11-9-24/h2-7,12H,8-11H2,1H3 |
| InChIKey | DYPFUDHBHGDRNY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|