C21H18F2N2O3 — CID 110558240
1-(2,5-difluorophenyl)-3-(4-methoxyphenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 110558240) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(4-methoxyphenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-difluorophenyl)-3-(4-methoxyphenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558240 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(4-methoxyphenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCCC3)C(=O)N(c3cc(F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C21H18F2N2O3/c1-28-15-7-4-13(5-8-15)18-19(24-10-2-3-11-24)21(27)25(20(18)26)17-12-14(22)6-9-16(17)23/h4-9,12H,2-3,10-11H2,1H3 |
| InChIKey | KZMCNBJWJPNLFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|