C17H11F2NO4 — CID 110581015
1-(2,5-difluorophenyl)-3-hydroxy-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110581015) has the molecular formula C17H11F2NO4 and a molecular weight of 331.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-hydroxy-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,5-difluorophenyl)-3-hydroxy-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581015 |
| Molecular Formula | C17H11F2NO4 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-hydroxy-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(O)C(=O)N(c3cc(F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C17H11F2NO4/c1-24-11-5-2-9(3-6-11)14-15(21)17(23)20(16(14)22)13-8-10(18)4-7-12(13)19/h2-8,21H,1H3 |
| InChIKey | DELZNYLIBDEVQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|