C18H14ClNO5 — CID 110581815
3-(4-chlorophenyl)-1-(3,5-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110581815) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(3,5-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-(3,5-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581815 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(3,5-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C18H14ClNO5/c1-24-13-7-12(8-14(9-13)25-2)20-17(22)15(16(21)18(20)23)10-3-5-11(19)6-4-10/h3-9,21H,1-2H3 |
| InChIKey | ZTNFEDWDVQMNHV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|