C22H14ClNO4 — CID 110581921
3-(4-chlorophenyl)-4-hydroxy-1-(4-phenoxyphenyl)pyrrole-2,5-dione (PubChem CID 110581921) has the molecular formula C22H14ClNO4 and a molecular weight of 391.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-hydroxy-1-(4-phenoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-hydroxy-1-(4-phenoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581921 |
| Molecular Formula | C22H14ClNO4 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 3-(4-chlorophenyl)-4-hydroxy-1-(4-phenoxyphenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(O)=C(c2ccc(Cl)cc2)C(=O)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H14ClNO4/c23-15-8-6-14(7-9-15)19-20(25)22(27)24(21(19)26)16-10-12-18(13-11-16)28-17-4-2-1-3-5-17/h1-13,25H |
| InChIKey | HNKOGMSQOMUNEY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|