C21H18Cl2N2O3 — CID 27739419
(3aS,6aR)-5-(4-butylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 27739419) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-butylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aR)-5-(4-butylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 27739419 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (3aS,6aR)-5-(4-butylphenyl)-3-(2,4-dichlorophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCCc1ccc(N2C(=O)[C@H]3C(c4ccc(Cl)cc4Cl)=NO[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O3/c1-2-3-4-12-5-8-14(9-6-12)25-20(26)17-18(24-28-19(17)21(25)27)15-10-7-13(22)11-16(15)23/h5-11,17,19H,2-4H2,1H3/t17-,19+/m0/s1 |
| InChIKey | VIVPJXUFFPSJCD-PKOBYXMFSA-N |
| XLogP | 4.63 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|