C34H30Br2N2O2S2 — CID 102197222
3,6-bis(5-bromothiophen-2-yl)-1,4-bis(4-butylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione (PubChem CID 102197222) has the molecular formula C34H30Br2N2O2S2 and a molecular weight of 722.57 g/mol. Its IUPAC name is 3,6-bis(5-bromothiophen-2-yl)-1,4-bis(4-butylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione.
| Compound Name | 3,6-bis(5-bromothiophen-2-yl)-1,4-bis(4-butylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102197222 |
| Molecular Formula | C34H30Br2N2O2S2 |
| Molecular Weight | 722.57 g/mol |
| Exact Mass | 720.01 |
| IUPAC Name | 3,6-bis(5-bromothiophen-2-yl)-1,4-bis(4-butylphenyl)pyrrolo[3,2-b]pyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(c3ccc(Br)s3)=C3C2=C(c2ccc(Br)s2)C(=O)N3c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C34H30Br2N2O2S2/c1-3-5-7-21-9-13-23(14-10-21)37-31-29(25-17-19-27(35)41-25)34(40)38(24-15-11-22(12-16-24)8-6-4-2)32(31)30(33(37)39)26-18-20-28(36)42-26/h9-20H,3-8H2,1-2H3 |
| InChIKey | QDLXUWJHOFVRTJ-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.57 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |