C29H29N3O3 — CID 110598016
1-(3,5-dimethylphenyl)-3-(2-methoxyphenyl)-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110598016) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(2-methoxyphenyl)-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(2-methoxyphenyl)-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598016 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(2-methoxyphenyl)-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(Nc2ccc(N3CCCC3)cc2)C(=O)N(c2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C29H29N3O3/c1-19-16-20(2)18-23(17-19)32-28(33)26(24-8-4-5-9-25(24)35-3)27(29(32)34)30-21-10-12-22(13-11-21)31-14-6-7-15-31/h4-5,8-13,16-18,30H,6-7,14-15H2,1-3H3 |
| InChIKey | AUDYIWVVMREIFK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|