C27H23F2N3O2 — CID 110586792
1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110586792) has the molecular formula C27H23F2N3O2 and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586792 |
| Molecular Formula | C27H23F2N3O2 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-piperidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc(N3CCCCC3)cc2)=C(c2ccc(F)cc2)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C27H23F2N3O2/c28-19-10-8-18(9-11-19)24-25(27(34)32(26(24)33)23-7-3-2-6-22(23)29)30-20-12-14-21(15-13-20)31-16-4-1-5-17-31/h2-3,6-15,30H,1,4-5,16-17H2 |
| InChIKey | JMHURVAFFUPMEF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|