C28H27N3O2 — CID 110561821
1-(2,4-dimethylphenyl)-3-phenyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110561821) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-phenyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-3-phenyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561821 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-phenyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(c3ccccc3)=C(N3CCN(c4ccccc4)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C28H27N3O2/c1-20-13-14-24(21(2)19-20)31-27(32)25(22-9-5-3-6-10-22)26(28(31)33)30-17-15-29(16-18-30)23-11-7-4-8-12-23/h3-14,19H,15-18H2,1-2H3 |
| InChIKey | NJDACFYYONYFRP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|