C30H30N2O2 — CID 110561813
3-(4-benzylpiperidin-1-yl)-1-(2,4-dimethylphenyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110561813) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-(2,4-dimethylphenyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-(2,4-dimethylphenyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561813 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-(2,4-dimethylphenyl)-4-phenylpyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(c3ccccc3)=C(N3CCC(Cc4ccccc4)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C30H30N2O2/c1-21-13-14-26(22(2)19-21)32-29(33)27(25-11-7-4-8-12-25)28(30(32)34)31-17-15-24(16-18-31)20-23-9-5-3-6-10-23/h3-14,19,24H,15-18,20H2,1-2H3 |
| InChIKey | DNSZKEPVOVLIAL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|