C29H28N2O2 — CID 110561944
3-(4-benzylpiperidin-1-yl)-1-(2-methylphenyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110561944) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-(2-methylphenyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-(2-methylphenyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561944 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-(2-methylphenyl)-4-phenylpyrrole-2,5-dione |
| SMILES | Cc1ccccc1N1C(=O)C(c2ccccc2)=C(N2CCC(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C29H28N2O2/c1-21-10-8-9-15-25(21)31-28(32)26(24-13-6-3-7-14-24)27(29(31)33)30-18-16-23(17-19-30)20-22-11-4-2-5-12-22/h2-15,23H,16-20H2,1H3 |
| InChIKey | PYTPRNYHCFLBAJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|