C27H26N2O3 — CID 110559101
3-(4-benzylpiperidin-1-yl)-1-(furan-2-ylmethyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110559101) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-(furan-2-ylmethyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-(furan-2-ylmethyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110559101 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-(furan-2-ylmethyl)-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(N2CCC(Cc3ccccc3)CC2)C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C27H26N2O3/c30-26-24(22-10-5-2-6-11-22)25(27(31)29(26)19-23-12-7-17-32-23)28-15-13-21(14-16-28)18-20-8-3-1-4-9-20/h1-12,17,21H,13-16,18-19H2 |
| InChIKey | GXRFDIBSPHVANF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|