C30H38N2O2 — CID 110560217
3-(4-benzylpiperidin-1-yl)-1-octyl-4-phenylpyrrole-2,5-dione (PubChem CID 110560217) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-octyl-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-octyl-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560217 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-octyl-4-phenylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(c2ccccc2)=C(N2CCC(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C30H38N2O2/c1-2-3-4-5-6-13-20-32-29(33)27(26-16-11-8-12-17-26)28(30(32)34)31-21-18-25(19-22-31)23-24-14-9-7-10-15-24/h7-12,14-17,25H,2-6,13,18-23H2,1H3 |
| InChIKey | YGCTWUQNVZDMRV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|