C27H27N3O2S — CID 110592310
1-(2-methylphenyl)-3-[4-(4-methylpiperidin-1-yl)anilino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110592310) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[4-(4-methylpiperidin-1-yl)anilino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2-methylphenyl)-3-[4-(4-methylpiperidin-1-yl)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110592310 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-(2-methylphenyl)-3-[4-(4-methylpiperidin-1-yl)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccccc1N1C(=O)C(Nc2ccc(N3CCC(C)CC3)cc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C27H27N3O2S/c1-18-13-15-29(16-14-18)21-11-9-20(10-12-21)28-25-24(23-8-5-17-33-23)26(31)30(27(25)32)22-7-4-3-6-19(22)2/h3-12,17-18,28H,13-16H2,1-2H3 |
| InChIKey | GLPJFFZEJVXGRK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|