C22H24N2O2S — CID 110555320
3-(3,5-dimethylpiperidin-1-yl)-1-(2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555320) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-1-(2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555320 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(2-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccccc1N1C(=O)C(c2cccs2)=C(N2CC(C)CC(C)C2)C1=O |
| InChI | InChI=1S/C22H24N2O2S/c1-14-11-15(2)13-23(12-14)20-19(18-9-6-10-27-18)21(25)24(22(20)26)17-8-5-4-7-16(17)3/h4-10,14-15H,11-13H2,1-3H3 |
| InChIKey | BLIGNTIDJJVJFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|